|
CAS#: 35271-57-9 Product: (4-Hydroxy-3-Methylphenyl)-Methylazanium Sulfate No suppilers available for the product. |
| Name | (4-Hydroxy-3-Methylphenyl)-Methylazanium Sulfate |
|---|---|
| Synonyms | (4-Hydroxy-3-Methyl-Phenyl)-Methyl-Ammonium Sulfate; (4-Hydroxy-3-Methylphenyl)-Methylammonium Sulfate; (4-Hydroxy-3-Methyl-Phenyl)-Methyl-Azanium Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 |
| CAS Registry Number | 35271-57-9 |
| EINECS | 252-475-0 |
| SMILES | O=[S]([O-])([O-])=O.C1=C([NH2+]C)C=CC(=C1C)O.C2=C([NH2+]C)C=CC(=C2C)O |
| InChI | 1S/2C8H11NO.H2O4S/c2*1-6-5-7(9-2)3-4-8(6)10;1-5(2,3)4/h2*3-5,9-10H,1-2H3;(H2,1,2,3,4) |
| InChIKey | BADYPBVKBVAOLH-UHFFFAOYSA-N |
| Boiling point | 269.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 136.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Hydroxy-3-Methylphenyl)-Methylazanium Sulfate |