|
CAS#: 35334-40-8 Product: (11R,- 12alpha)-13-Hydroxy-2- methoxy-11,12-[methylenebis(oxy)]-Picras-2-ene-1,16-dione No suppilers available for the product. |
| Name | (11R,- 12alpha)-13-Hydroxy-2- methoxy-11,12-[methylenebis(oxy)]-Picras-2-ene-1,16-dione |
|---|---|
| Synonyms | Aids057110; Nigakilactone-L |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.47 |
| CAS Registry Number | 35334-40-8 |
| SMILES | [C@]23([C@@H]4[C@@]1([C@@H](CC(O[C@@H]1C[C@H]2[C@H](C)C=C(C3=O)OC)=O)[C@@]([C@H]5[C@H]4OCO5)(O)C)C)C |
| InChI | 1S/C22H30O7/c1-10-6-12(26-5)18(24)20(2)11(10)7-14-21(3)13(8-15(23)29-14)22(4,25)19-16(17(20)21)27-9-28-19/h6,10-11,13-14,16-17,19,25H,7-9H2,1-5H3/t10-,11+,13-,14-,16+,17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | DUAQCTANPNATFA-KOEFXMDHSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.934°C at 760 mmHg (Cal.) |
| Flash point | 208.14°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (11R,- 12alpha)-13-Hydroxy-2- methoxy-11,12-[methylenebis(oxy)]-Picras-2-ene-1,16-dione |