|
CAS#: 35465-71-5 Product: 2-Phenylnaphthalene No suppilers available for the product. |
| Name | 2-Phenylnaphthalene |
|---|---|
| Synonyms | Nsc 407592; Naphthalene, 2-Phenyl- (8Ci)(9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 35465-71-5 |
| EINECS | 210-324-6 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H12/c1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16/h1-12H |
| InChIKey | TURIHPLQSRVWHU-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Melting point | 105°C (Expl.) |
| Boiling point | 345.498°C at 760 mmHg (Cal.) |
| Flash point | 155.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylnaphthalene |