|
CAS#: 3548-78-5 Product: 6,10-Dimethylundeca-3,5,9-Trien-2-One No suppilers available for the product. |
| Name | 6,10-Dimethylundeca-3,5,9-Trien-2-One |
|---|---|
| Synonyms | (3E,5E)-6,10-Dimethylundeca-3,5,9-Trien-2-One; Trans-.Psi.-Ionone; 3,5,9-Undecatrien-2-One, 6,10-Dimethyl, #1 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 3548-78-5 |
| SMILES | C(\C(=C\C=C\C(=O)C)C)CC=C(C)C |
| InChI | 1S/C13H20O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h6-7,9-10H,5,8H2,1-4H3/b10-6+,12-9+ |
| InChIKey | JXJIQCXXJGRKRJ-KOOBJXAQSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.8±19.0°C at 760 mmHg (Cal.) |
| Flash point | 129.0±14.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,10-Dimethylundeca-3,5,9-Trien-2-One |