|
CAS#: 35569-11-0 Product: Ditert-Butyl-Dimethylstannane No suppilers available for the product. |
| Name | Ditert-Butyl-Dimethylstannane |
|---|---|
| Synonyms | Ditert-Butyl-Dimethyl-Stannane; Stannane, Bis(1,1-Dimethylethyl)Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H24Sn |
| Molecular Weight | 262.99 |
| CAS Registry Number | 35569-11-0 |
| EINECS | 252-622-9 |
| SMILES | CC([Sn](C(C)(C)C)(C)C)(C)C |
| InChI | 1S/2C4H9.2CH3.Sn/c2*1-4(2)3;;;/h2*1-3H3;2*1H3; |
| InChIKey | BYZIKHGJWTVMSX-UHFFFAOYSA-N |
| Boiling point | 206.966°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 77.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ditert-Butyl-Dimethylstannane |