|
CAS#: 3560-71-2 Product: 5,8-Dihydroxy-2,6,7-Trimethoxynaphthalene-1,4-Dione No suppilers available for the product. |
| Name | 5,8-Dihydroxy-2,6,7-Trimethoxynaphthalene-1,4-Dione |
|---|---|
| Synonyms | 5,8-Dihydroxy-2,6,7-Trimethoxy-Naphthalene-1,4-Dione; 5,8-Dihydroxy-2,6,7-Trimethoxy-1,4-Naphthoquinone; 1,4-Naphthalenedione, 5,8-Dihydroxy-2,3,6-Trimethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 |
| CAS Registry Number | 3560-71-2 |
| SMILES | COC1=C(O)C2=C(C(=C1OC)O)C(=O)C=C(OC)C2=O |
| InChI | 1S/C13H12O7/c1-18-6-4-5(14)7-8(9(6)15)11(17)13(20-3)12(19-2)10(7)16/h4,16-17H,1-3H3 |
| InChIKey | FNWLMRVSPWHCBU-UHFFFAOYSA-N |
| Density | 1.516g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.027°C at 760 mmHg (Cal.) |
| Flash point | 235.554°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8-Dihydroxy-2,6,7-Trimethoxynaphthalene-1,4-Dione |