|
CAS#: 35614-21-2 Product: 2-(9-Oxoxanthen-4-Yl)Acetic Acid No suppilers available for the product. |
| Name | 2-(9-Oxoxanthen-4-Yl)Acetic Acid |
|---|---|
| Synonyms | 2-(9-Oxo-4-Xanthenyl)Acetic Acid; 2-(9-Ketoxanthen-4-Yl)Acetic Acid; 2-(9-Oxoxanthen-4-Yl)Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 35614-21-2 |
| SMILES | C1=CC=C(C2=C1C(C3=C(O2)C=CC=C3)=O)CC(O)=O |
| InChI | 1S/C15H10O4/c16-13(17)8-9-4-3-6-11-14(18)10-5-1-2-7-12(10)19-15(9)11/h1-7H,8H2,(H,16,17) |
| InChIKey | ABGYSGBNWQSGJD-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.658°C at 760 mmHg (Cal.) |
| Flash point | 196.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(9-Oxoxanthen-4-Yl)Acetic Acid |