|
CAS#: 3562-69-4 Product: 2,2,4-Trimethyl-6-Phenyl-1H-Quinoline No suppilers available for the product. |
| Name | 2,2,4-Trimethyl-6-Phenyl-1H-Quinoline |
|---|---|
| Synonyms | 1,2-Dihydro-2,2,4-Trimethyl-6-Phenylquinoline; 2,2,4-Trimethyl-6-Phenyl-1,2-Dihydroquinoline; 4-20-00-04116 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.35 |
| CAS Registry Number | 3562-69-4 |
| SMILES | C1=CC(=CC2=C1NC(C=C2C)(C)C)C3=CC=CC=C3 |
| InChI | 1S/C18H19N/c1-13-12-18(2,3)19-17-10-9-15(11-16(13)17)14-7-5-4-6-8-14/h4-12,19H,1-3H3 |
| InChIKey | XKBGEVHKVFIMLY-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.793°C at 760 mmHg (Cal.) |
| Flash point | 203.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethyl-6-Phenyl-1H-Quinoline |