|
CAS#: 35629-61-9 Product: 6-(2-Chlorophenyl)-6H-[1,3]Oxazolo[2,3-f][1,3,5]Triazine-4,7-Dione No suppilers available for the product. |
| Name | 6-(2-Chlorophenyl)-6H-[1,3]Oxazolo[2,3-f][1,3,5]Triazine-4,7-Dione |
|---|---|
| Synonyms | 6-(2-Chlorophenyl)-6H-Oxazolo[2,3-F][1,3,5]Triazine-4,7-Dione; 6-(2-Chlorophenyl)-6H-Oxazolo[2,3-F][1,3,5]Triazine-4,7-Quinone; 6-(O-Chlorophenyl)Oxazolo(3,2-A)-Sym-Triazine-5,7-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H6ClN3O3 |
| Molecular Weight | 263.64 |
| CAS Registry Number | 35629-61-9 |
| SMILES | C1=CC=CC(=C1C3N2C(=NC=NC2=O)OC3=O)Cl |
| InChI | 1S/C11H6ClN3O3/c12-7-4-2-1-3-6(7)8-9(16)18-11-14-5-13-10(17)15(8)11/h1-5,8H |
| InChIKey | PSOXJXIXRPKCEP-UHFFFAOYSA-N |
| Density | 1.703g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.749°C at 760 mmHg (Cal.) |
| Flash point | 174.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Chlorophenyl)-6H-[1,3]Oxazolo[2,3-f][1,3,5]Triazine-4,7-Dione |