|
CAS#: 3562-98-9 Product: Sodium 2,2,3-Trichloropropanoate No suppilers available for the product. |
| Name | Sodium 2,2,3-Trichloropropanoate |
|---|---|
| Synonyms | Sodium 2,2,3-Trichloropropionate; Propanoic Acid, 2,2,3-Trichloro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C3H2Cl3NaO2 |
| Molecular Weight | 199.40 |
| CAS Registry Number | 3562-98-9 |
| SMILES | C(Cl)C(Cl)(Cl)C([O-])=O.[Na+] |
| InChI | 1S/C3H3Cl3O2.Na/c4-1-3(5,6)2(7)8;/h1H2,(H,7,8);/q;+1/p-1 |
| InChIKey | LUNDRZAKDNXYRX-UHFFFAOYSA-M |
| Boiling point | 223.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 88.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,2,3-Trichloropropanoate |