|
CAS#: 356-47-8 Product: 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(Trifluoromethyl)Oxane No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(Trifluoromethyl)Oxane |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(Trifluoromethyl)Tetrahydropyran; 2,2,3,3,4,4,5,5,6-Nonafluorotetrahydro-6-(Trifluoromethyl)-2H-Pyran |
| Molecular Structure | ![]() |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.05 |
| CAS Registry Number | 356-47-8 |
| EINECS | 206-606-3 |
| SMILES | O1C(F)(C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | 1S/C6F12O/c7-1(8)2(9,10)4(13,5(14,15)16)19-6(17,18)3(1,11)12 |
| InChIKey | ZCPSRQQUNLMQMM-UHFFFAOYSA-N |
| Density | 1.753g/cm3 (Cal.) |
|---|---|
| Boiling point | 45.875°C at 760 mmHg (Cal.) |
| Flash point | -13.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(Trifluoromethyl)Oxane |