|
CAS#: 3564-85-0 Product: (6aS,12aS)-2,3,9-Trimethoxy-6a,12a-Dihydro-6H-Chromeno[3,4-b]Chromen-12-One No suppilers available for the product. |
| Name | (6aS,12aS)-2,3,9-Trimethoxy-6a,12a-Dihydro-6H-Chromeno[3,4-b]Chromen-12-One |
|---|---|
| Synonyms | Spectrum2_000183; Spectrum5_000292; Spbio_000105 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 |
| CAS Registry Number | 3564-85-0 |
| SMILES | [C@@H]12C(C4=C(O[C@@H]1COC3=C2C=C(C(=C3)OC)OC)C=C(C=C4)OC)=O |
| InChI | 1S/C19H18O6/c1-21-10-4-5-11-14(6-10)25-17-9-24-13-8-16(23-3)15(22-2)7-12(13)18(17)19(11)20/h4-8,17-18H,9H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | PYRZRPSTTNKOCS-MSOLQXFVSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.553°C at 760 mmHg (Cal.) |
| Flash point | 223.391°C (Cal.) |
| (1) | Yeh et al.. Discovering chemical modifiers of oncogene-regulated hematopoietic differentiation, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (6aS,12aS)-2,3,9-Trimethoxy-6a,12a-Dihydro-6H-Chromeno[3,4-b]Chromen-12-One |