|
CAS#: 3567-72-4 Product: 3-(Trichloromethylsulfanyl)-1,3-Benzoxazol-2-One No suppilers available for the product. |
| Name | 3-(Trichloromethylsulfanyl)-1,3-Benzoxazol-2-One |
|---|---|
| Synonyms | 3-(Trichloromethylthio)-1,3-Benzoxazol-2-One; 2(3H)-Benzoxazolone, 3-((Trichloromethyl)Thio)- (9Ci); 2-Benzoxazolinone, 3-((Trichloromethyl)Thio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl3NO2S |
| Molecular Weight | 284.54 |
| CAS Registry Number | 3567-72-4 |
| SMILES | C1=CC=CC2=C1N(C(=O)O2)SC(Cl)(Cl)Cl |
| InChI | 1S/C8H4Cl3NO2S/c9-8(10,11)15-12-5-3-1-2-4-6(5)14-7(12)13/h1-4H |
| InChIKey | JJFNGSFEVKIGQQ-UHFFFAOYSA-N |
| Density | 1.747g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.595°C at 760 mmHg (Cal.) |
| Flash point | 128.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Trichloromethylsulfanyl)-1,3-Benzoxazol-2-One |