|
CAS#: 3572-86-9 Product: N-(4-Chlorophenyl)-N-(Trichloromethylsulfanyl)Methanesulfonamide No suppilers available for the product. |
| Name | N-(4-Chlorophenyl)-N-(Trichloromethylsulfanyl)Methanesulfonamide |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-N-(Trichloromethylthio)Methanesulfonamide; 4-15-00-00017 (Beilstein Handbook Reference); Brn 2882892 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl4NO2S2 |
| Molecular Weight | 355.08 |
| CAS Registry Number | 3572-86-9 |
| SMILES | C1=CC(=CC=C1N([S](C)(=O)=O)SC(Cl)(Cl)Cl)Cl |
| InChI | 1S/C8H7Cl4NO2S2/c1-17(14,15)13(16-8(10,11)12)7-4-2-6(9)3-5-7/h2-5H,1H3 |
| InChIKey | IPCRTPZFAGFLMA-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.828°C at 760 mmHg (Cal.) |
| Flash point | 181.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Chlorophenyl)-N-(Trichloromethylsulfanyl)Methanesulfonamide |