Online Database of Chemicals from Around the World
|
CAS#: 3582-25-0 Product: Methyl 7-Ethyl-1,4a,7-Trimethyl-3,4,5,6,8,9,10,10a-Octahydro-2H-Phenanthrene-1-Carboxylate No suppilers available for the product. |
| Name | Methyl 7-Ethyl-1,4a,7-Trimethyl-3,4,5,6,8,9,10,10a-Octahydro-2H-Phenanthrene-1-Carboxylate |
|---|---|
| Synonyms | 7-Ethyl-1,4A,7-Trimethyl-3,4,5,6,8,9,10,10A-Octahydro-2H-Phenanthrene-1-Carboxylic Acid Methyl Ester; 1-Phenanthrenecarboxylic Acid, 7-Ethyl-1,2,3,4,4A,5,6,7,8,9,10,10A-Dodecahydro-1,4A,7-Trimethyl-, Methyl Ester, [1R-(1.Alpha.,4A.Beta.,7.Beta.,10A.Alpha.)]-; Methyl 8-Pimaren-18-Oate |
| Molecular Structure |  |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 |
| CAS Registry Number | 3582-25-0 (33952-78-2) |
| SMILES | C(C1(CC2=C(CC1)C3(C(CC2)C(CCC3)(C(=O)OC)C)C)C)C |
| InChI | 1S/C21H34O2/c1-6-19(2)13-10-16-15(14-19)8-9-17-20(16,3)11-7-12-21(17,4)18(22)23-5/h17H,6-14H2,1-5H3 |
| InChIKey | LZUSHGHGVLPXFI-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.259°C at 760 mmHg (Cal.) |
| Flash point | 181.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 7-Ethyl-1,4a,7-Trimethyl-3,4,5,6,8,9,10,10a-Octahydro-2H-Phenanthrene-1-Carboxylate |