|
CAS#: 35873-47-3 Product: 8-Cyclopropyl-1,3-Dimethyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-Cyclopropyl-1,3-Dimethyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Cyclopropyl-1,3-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 8-Cyclopropyl-3,7-Dihydro-1,3-Dimethyl-; 8-Cyclopropyltheophylline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 |
| CAS Registry Number | 35873-47-3 |
| SMILES | CN1C2=C(C(N(C1=O)C)=O)[NH]C(=N2)C3CC3 |
| InChI | 1S/C10H12N4O2/c1-13-8-6(9(15)14(2)10(13)16)11-7(12-8)5-3-4-5/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | SZMWFUBOZRDQPO-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.794°C at 760 mmHg (Cal.) |
| Flash point | 260.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Cyclopropyl-1,3-Dimethyl-7H-Purine-2,6-Dione |