|
CAS#: 35878-48-9 Product: 1-(3-Methylbutyl)-2-Nitro-1-Nitrosoguanidine No suppilers available for the product. |
| Name | 1-(3-Methylbutyl)-2-Nitro-1-Nitrosoguanidine |
|---|---|
| Synonyms | 1-Isopentyl-2-Nitro-1-Nitroso-Guanidine; 1-Isopentyl-2-Nitro-1-Nitrosoguanidine; 1-Isoamyl-2-Nitro-1-Nitroso-Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13N5O3 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 35878-48-9 |
| SMILES | C(N(N=O)C(=N/[N+]([O-])=O)/N)CC(C)C |
| InChI | 1S/C6H13N5O3/c1-5(2)3-4-10(9-12)6(7)8-11(13)14/h5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | WYFTYNAZEMXYFM-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.387°C at 760 mmHg (Cal.) |
| Flash point | 143.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Methylbutyl)-2-Nitro-1-Nitrosoguanidine |