|
CAS#: 35944-01-5 Product: 6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl-3H-Inden-1-One No suppilers available for the product. |
| Name | 6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl-3H-Inden-1-One |
|---|---|
| Synonyms | 6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl-Indan-1-One; 6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl-1-Indanone; 1H-Inden-1-One, 2,3-Dihydro-6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 |
| CAS Registry Number | 35944-01-5 |
| SMILES | C1=C2C(=C(C(=C1C)CCOC)C)C(C(C)(C)C2)=O |
| InChI | 1S/C16H22O2/c1-10-8-12-9-16(3,4)15(17)14(12)11(2)13(10)6-7-18-5/h8H,6-7,9H2,1-5H3 |
| InChIKey | OJOSRHYPGDXYOR-UHFFFAOYSA-N |
| Density | 1.019g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.656°C at 760 mmHg (Cal.) |
| Flash point | 150.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Methoxyethyl)-2,2,5,7-Tetramethyl-3H-Inden-1-One |