|
CAS#: 3598-29-6 Product: 4-(4-Hydroxyphenyl)Benzene-1,2-Diol No suppilers available for the product. |
| Name | 4-(4-Hydroxyphenyl)Benzene-1,2-Diol |
|---|---|
| Synonyms | 4-(4-Hydroxyphenyl)Pyrocatechol; (1,1'-Biphenyl)-3,4,4'-Triol; 3,4,4'-Trihydroxybiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 3598-29-6 |
| SMILES | C2=C(C1=CC=C(O)C=C1)C=CC(=C2O)O |
| InChI | 1S/C12H10O3/c13-10-4-1-8(2-5-10)9-3-6-11(14)12(15)7-9/h1-7,13-15H |
| InChIKey | CNIACUISPHFTGQ-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.537°C at 760 mmHg (Cal.) |
| Flash point | 209.928°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Hydroxyphenyl)Benzene-1,2-Diol |