|
CAS#: 3608-17-1 Product: 1-(4,7,7-Trimethyl-3-Bicyclo[4.1.0]Heptanyl)Ethanol No suppilers available for the product. |
| Name | 1-(4,7,7-Trimethyl-3-Bicyclo[4.1.0]Heptanyl)Ethanol |
|---|---|
| Synonyms | 1-(4,7,7-Trimethylnorcaran-3-Yl)Ethanol; 1-(4,7,7-Trimethyl-3-Norcaranyl)Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 3608-17-1 |
| EINECS | 222-773-5 |
| SMILES | CC1(C2C1CC(C(C2)C(O)C)C)C |
| InChI | 1S/C12H22O/c1-7-5-10-11(12(10,3)4)6-9(7)8(2)13/h7-11,13H,5-6H2,1-4H3 |
| InChIKey | KJTWLZQJNFGTAH-UHFFFAOYSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.849°C at 760 mmHg (Cal.) |
| Flash point | 109.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4,7,7-Trimethyl-3-Bicyclo[4.1.0]Heptanyl)Ethanol |