|
CAS#: 3608-78-4 Product: [(3-Methylpyridin-4-Yl)Methylideneamino]Thiourea No suppilers available for the product. |
| Name | [(3-Methylpyridin-4-Yl)Methylideneamino]Thiourea |
|---|---|
| Synonyms | [(3-Methyl-4-Pyridyl)Methyleneamino]Thiourea; 4-Formyl-3-Methylpyridine Thiosemicarbazone; 5-21-07-00414 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.25 |
| CAS Registry Number | 3608-78-4 |
| SMILES | C1=CN=CC(=C1/C=N/NC(=S)N)C |
| InChI | 1S/C8H10N4S/c1-6-4-10-3-2-7(6)5-11-12-8(9)13/h2-5H,1H3,(H3,9,12,13)/b11-5+ |
| InChIKey | UJWSYUQARHWWFW-VZUCSPMQSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.541°C at 760 mmHg (Cal.) |
| Flash point | 174.269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(3-Methylpyridin-4-Yl)Methylideneamino]Thiourea |