|
CAS#: 3651-02-3 Product: (4E)-4-(Phenylhydrazinylidene)Naphthalen-1-One No suppilers available for the product. |
| Name | (4E)-4-(Phenylhydrazinylidene)Naphthalen-1-One |
|---|---|
| Synonyms | 4-(Phenylhydrazinylidene)Naphthalen-1-One; (4E)-4-(Phenylhydrazono)Naphthalen-1-One; 4-(Phenylhydrazono)Naphthalen-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 |
| CAS Registry Number | 3651-02-3 |
| EINECS | 222-891-7 |
| SMILES | C1=C/2C(=CC=C1)C(=O)C=CC2=N/NC3=CC=CC=C3 |
| InChI | 1S/C16H12N2O/c19-16-11-10-15(13-8-4-5-9-14(13)16)18-17-12-6-2-1-3-7-12/h1-11,17H/b18-15+ |
| InChIKey | NZZPXZGSADNPOR-OBGWFSINSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.604°C at 760 mmHg (Cal.) |
| Flash point | 199.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4E)-4-(Phenylhydrazinylidene)Naphthalen-1-One |