|
CAS#: 36542-71-9 Product: 2-[[2-(Dibromomethyl)Phenoxy]Methyl]Oxirane No suppilers available for the product. |
| Name | 2-[[2-(Dibromomethyl)Phenoxy]Methyl]Oxirane |
|---|---|
| Synonyms | (((Dibromo-O-Tolyl)Oxy)Methyl)Oxirane; Oxirane, ((Dibromo-2-Methylphenoxy)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 |
| CAS Registry Number | 36542-71-9 |
| EINECS | 253-094-2 |
| SMILES | C1=C(C(=CC=C1)OCC2OC2)C(Br)Br |
| InChI | 1S/C10H10Br2O2/c11-10(12)8-3-1-2-4-9(8)14-6-7-5-13-7/h1-4,7,10H,5-6H2 |
| InChIKey | RUBIQRSGTVJYHR-UHFFFAOYSA-N |
| Density | 1.817g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.437°C at 760 mmHg (Cal.) |
| Flash point | 149.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[2-(Dibromomethyl)Phenoxy]Methyl]Oxirane |