|
CAS#: 36690-96-7 Product: (2R)-2-[4-(3-Oxo-1H-Isoindol-2-Yl)Phenyl]Butanoic Acid No suppilers available for the product. |
| Name | (2R)-2-[4-(3-Oxo-1H-Isoindol-2-Yl)Phenyl]Butanoic Acid |
|---|---|
| Synonyms | (2R)-2-[4-(1-Oxoisoindolin-2-Yl)Phenyl]Butanoic Acid; (2R)-2-[4-(1-Oxo-2-Isoindolinyl)Phenyl]Butanoic Acid; (2R)-2-[4-(1-Ketoisoindolin-2-Yl)Phenyl]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 |
| CAS Registry Number | 36690-96-7 |
| SMILES | [C@@H](C3=CC=C(N1C(C2=C(C1)C=CC=C2)=O)C=C3)(C(O)=O)CC |
| InChI | 1S/C18H17NO3/c1-2-15(18(21)22)12-7-9-14(10-8-12)19-11-13-5-3-4-6-16(13)17(19)20/h3-10,15H,2,11H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | AYDXAULLCROVIT-OAHLLOKOSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.056°C at 760 mmHg (Cal.) |
| Flash point | 267.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-[4-(3-Oxo-1H-Isoindol-2-Yl)Phenyl]Butanoic Acid |