|
CAS#: 36821-08-6 Product: 4-Methylnaphtho[3,2-b][1]Benzothiole No suppilers available for the product. |
| Name | 4-Methylnaphtho[3,2-b][1]Benzothiole |
|---|---|
| Synonyms | 4-Methylnaphtho[3,2-B]Benzothiophene; 4-Methylbenzo(B)Naphtho(2,3-D)Thiophene; Benzo(B)Naphtho(2,3-D)Thiophene, 4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12S |
| Molecular Weight | 248.34 |
| CAS Registry Number | 36821-08-6 |
| SMILES | C1=CC=C(C2=C1C3=C(S2)C=C4C(=C3)C=CC=C4)C |
| InChI | 1S/C17H12S/c1-11-5-4-8-14-15-9-12-6-2-3-7-13(12)10-16(15)18-17(11)14/h2-10H,1H3 |
| InChIKey | YTNVYFJVEVMZDG-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.512°C at 760 mmHg (Cal.) |
| Flash point | 168.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylnaphtho[3,2-b][1]Benzothiole |