|
CAS#: 36877-42-6 Product: L-Glutamic acid, polymer with L-lysine and L-phenylalanine No suppilers available for the product. |
| Name | L-Glutamic acid, polymer with L-lysine and L-phenylalanine |
|---|---|
| Synonyms | (2S)-2-Aminopentanedioic Acid; (2S)-2-Amino-3-Phenyl-Propanoic Acid; (2S)-2,6-Diaminohexanoic Acid; (2S)-2-Aminoglutaric Acid; (2S)-2-Amino-3-Phenyl-Propionic Acid; (2S)-2,6-Diaminohexanoic Acid |
| Molecular Formula | C20H34N4O8 |
| Molecular Weight | 458.51 |
| CAS Registry Number | 36877-42-6 |
| SMILES | [C@H](N)(CC1=CC=CC=C1)C(=O)O.[C@@H](N)(C(=O)O)CCC(=O)O.[C@@H](N)(C(=O)O)CCCCN |
| InChI | 1S/C9H11NO2.C6H14N2O2.C5H9NO4/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-2-4(7)8/h1-5,8H,6,10H2,(H,11,12);5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t8-;5-;3-/m000/s1 |
| InChIKey | YWVHAOSDNDVABQ-NEJMAHLNSA-N |
| Boiling point | 307.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Glutamic acid, polymer with L-lysine and L-phenylalanine |