|
CAS#: 36911-94-1 Product: 6,8-Diethylbenzo[b]Phenanthrene No suppilers available for the product. |
| Name | 6,8-Diethylbenzo[b]Phenanthrene |
|---|---|
| Synonyms | 6,8-Diethylbenz(A)Anthracene; Brn 2274988; Benz(A)Anthracene, 6,8-Diethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 36911-94-1 |
| SMILES | C1=C4C(=C3C(=C1CC)C=C2C(=CC=CC2=C3)CC)C=CC=C4 |
| InChI | 1S/C22H20/c1-3-15-9-7-10-18-13-22-19-11-6-5-8-17(19)12-16(4-2)21(22)14-20(15)18/h5-14H,3-4H2,1-2H3 |
| InChIKey | RHTUEBPQRSQIMX-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.124°C at 760 mmHg (Cal.) |
| Flash point | 238.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Diethylbenzo[b]Phenanthrene |