|
CAS#: 3704-44-7 Product: Dimethyl-Bis(Trimethylsilyl)Silane No suppilers available for the product. |
| Name | Dimethyl-Bis(Trimethylsilyl)Silane |
|---|---|
| Synonyms | Octamethyltrisilane; Trisilane, Octamethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H24Si3 |
| Molecular Weight | 204.54 |
| CAS Registry Number | 3704-44-7 |
| SMILES | C[Si]([Si](C)(C)C)([Si](C)(C)C)C |
| InChI | 1S/C8H24Si3/c1-9(2,3)11(7,8)10(4,5)6/h1-8H3 |
| InChIKey | DDIMPUQNMJIVKL-UHFFFAOYSA-N |
| Density | 0.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 168.839°C at 760 mmHg (Cal.) |
| Flash point | 35.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-Bis(Trimethylsilyl)Silane |