|
CAS#: 37130-03-3 Product: Butyl acrylate, methacrylamide, methylolmethacrylamide polymer No suppilers available for the product. |
| Name | Butyl acrylate, methacrylamide, methylolmethacrylamide polymer |
|---|---|
| Synonyms | Butyl Prop-2-Enoate; N-(Hydroxymethyl)-2-Methyl-Prop-2-Enamide; 2-Methylprop-2-Enamide; N-(Hydroxymethyl)-2-Methylprop-2-Enamide; 2-Methylprop-2-Enamide; Prop-2-Enoic Acid Butyl Ester |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 37130-03-3 |
| SMILES | C(OC(=O)C=C)CCC.C(O)NC(=O)C(=C)C.CC(C(=O)N)=C |
| InChI | 1S/C7H12O2.C5H9NO2.C4H7NO/c1-3-5-6-9-7(8)4-2;1-4(2)5(8)6-3-7;1-3(2)4(5)6/h4H,2-3,5-6H2,1H3;7H,1,3H2,2H3,(H,6,8);1H2,2H3,(H2,5,6) |
| InChIKey | DSDZPIIFWAGROE-UHFFFAOYSA-N |
| Boiling point | 145.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 39.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl acrylate, methacrylamide, methylolmethacrylamide polymer |