Online Database of Chemicals from Around the World
|
CAS#: 3718-80-7 Product: 6-Acetyl-4,5,7,8-Tetrahydroxynaphthalene-1,2-Dione No suppilers available for the product. |
| Name | 6-Acetyl-4,5,7,8-Tetrahydroxynaphthalene-1,2-Dione |
|---|---|
| Synonyms | 6-Acetyl-4,5,7,8-Tetrahydroxy-Naphthalene-1,2-Dione; 6-Acetyl-4,5,7,8-Tetrahydroxy-1,2-Naphthoquinone; 6-Ethanoyl-4,5,7,8-Tetrahydroxy-Naphthalene-1,2-Dione |
| Molecular Structure |  |
| Molecular Formula | C12H8O7 |
| Molecular Weight | 264.19 |
| CAS Registry Number | 3718-80-7 |
| SMILES | CC(=O)C1=C(O)C2=C(C(=C1O)O)C(=O)C(=O)C=C2O |
| InChI | 1S/C12H8O7/c1-3(13)6-10(17)7-4(14)2-5(15)9(16)8(7)12(19)11(6)18/h2,14,17-19H,1H3 |
| InChIKey | XCJXHYOEVKKMGD-UHFFFAOYSA-N |
| Density | 1.83g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.098°C at 760 mmHg (Cal.) |
| Flash point | 362.17°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Acetyl-4,5,7,8-Tetrahydroxynaphthalene-1,2-Dione |