| Name | [(Z)-1,2-Dibromo-2-Phenylethenyl]Benzene |
|---|---|
| Synonyms | [(Z)-1,2-Dibromo-2-Phenyl-Vinyl]Benzene; [(Z)-1,2-Dibromo-2-Phenylvinyl]Benzene; [(Z)-1,2-Dibromo-2-Phenyl-Ethenyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Br2 |
| Molecular Weight | 338.04 |
| CAS Registry Number | 3720-09-0 |
| SMILES | C2=C(\C(=C(Br)/C1=CC=CC=C1)Br)C=CC=C2 |
| InChI | 1S/C14H10Br2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H/b14-13- |
| InChIKey | XNJYRGMCZCPTJE-YPKPFQOOSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Melting point | 225-230°C (Expl.) |
| Boiling point | 366.033°C at 760 mmHg (Cal.) |
| Flash point | 204.529°C (Cal.) |
| (1) | J. C. Barnes and J. A. Chudek. cis-1,2-Dibromo-1,2-diphenylethene-diphenylethyne (2/1), Acta Cryst. (2002). E58, o703-o705 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [(Z)-1,2-Dibromo-2-Phenylethenyl]Benzene |