|
CAS#: 37219-74-2 Product: Dansyl Phosphatidylethanolamine No suppilers available for the product. |
| Name | Dansyl Phosphatidylethanolamine |
|---|---|
| Synonyms | 2-Aminoethyl 2,3-Dihydroxypropyl Hydrogen Phosphate; 5-Dimethylamino-1-Naphthalenesulfonic Acid; 2-Aminoethyl Glyceryl Hydrogen Phosphate; 5-Dimethylaminonaphthalene-1-Sulfonic Acid; Dansyl Sn-Glycero-3-Phosphoethanolamine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H27N2O9PS |
| Molecular Weight | 466.44 |
| CAS Registry Number | 37219-74-2 |
| SMILES | C1=CC=C(N(C)C)C2=CC=CC(=C12)[S](=O)(=O)O.C(O[P](OCCN)(=O)O)C(O)CO |
| InChI | 1S/C12H13NO3S.C5H14NO6P/c1-13(2)11-7-3-6-10-9(11)5-4-8-12(10)17(14,15)16;6-1-2-11-13(9,10)12-4-5(8)3-7/h3-8H,1-2H3,(H,14,15,16);5,7-8H,1-4,6H2,(H,9,10) |
| InChIKey | FXOFHRIXQOZXNZ-UHFFFAOYSA-N |
| Boiling point | 743.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 403.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dansyl Phosphatidylethanolamine |