|
CAS#: 3722-52-9 Product: 3-Methoxyxanthen-9-One No suppilers available for the product. |
| Name | 3-Methoxyxanthen-9-One |
|---|---|
| Synonyms | 3-Methoxy-9-Xanthenone; 3-Methoxyxanthone; 3-Methoxy-9H-Xanthen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 3722-52-9 |
| SMILES | C1=C(OC)C=CC2=C1OC3=C(C2=O)C=CC=C3 |
| InChI | 1S/C14H10O3/c1-16-9-6-7-11-13(8-9)17-12-5-3-2-4-10(12)14(11)15/h2-8H,1H3 |
| InChIKey | HGWDKWJYTURSFE-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.207°C at 760 mmHg (Cal.) |
| Flash point | 180.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxyxanthen-9-One |