|
CAS#: 37242-45-8 Product: Phosphoric Acid, Hexyl Ester, Potassium Salt No suppilers available for the product. |
| Name | Phosphoric Acid, Hexyl Ester, Potassium Salt |
|---|---|
| Synonyms | Phosphoric Acid, Monohexyl Ester, Dipotassium Salt; Phosphoric Acid, Hexyl Ester, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13K2O4P |
| Molecular Weight | 258.34 |
| CAS Registry Number | 37242-45-8 (56960-85-1) |
| EINECS | 260-466-8 |
| SMILES | C(O[P]([O-])([O-])=O)CCCCC.[K+].[K+] |
| InChI | 1S/C6H15O4P.2K/c1-2-3-4-5-6-10-11(7,8)9;;/h2-6H2,1H3,(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | SVQIBPUYKCOPNT-UHFFFAOYSA-L |
| Boiling point | 299.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid, Hexyl Ester, Potassium Salt |