|
CAS#: 372983-17-0 Product: 1-Methoxy-4-{[4-(trans-4-Pentylcyclohexyl)Phenyl]Ethynyl}Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-{[4-(trans-4-Pentylcyclohexyl)Phenyl]Ethynyl}Benzene |
|---|---|
| Synonyms | TRANS-1-( |
| Molecular Structure | ![]() |
| Molecular Formula | C26H32O |
| Molecular Weight | 360.53 |
| CAS Registry Number | 372983-17-0 |
| SMILES | CCCCC[C@H]1CC[C@@H](CC1)c2ccc(cc2)C#Cc3ccc(cc3)OC |
| InChI | 1S/C26H32O/c1-3-4-5-6-21-9-15-24(16-10-21)25-17-11-22(12-18-25)7-8-23-13-19-26(27-2)20-14-23/h11-14,17-21,24H,3-6,9-10,15-16H2,1-2H3/t21-,24- |
| InChIKey | XCMYRYNJLWEIGL-SAIGFBBZSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.464°C at 760 mmHg (Cal.) |
| Flash point | 251.253°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-{[4-(trans-4-Pentylcyclohexyl)Phenyl]Ethynyl}Benzene |