|
CAS#: 3741-12-6 Product: 6-Chloro-4-Nitro-1-Oxidoquinolin-1-Ium No suppilers available for the product. |
| Name | 6-Chloro-4-Nitro-1-Oxidoquinolin-1-Ium |
|---|---|
| Synonyms | 6-Chloro-4-Nitro-1-Oxido-Quinolin-1-Ium; 6-Chloro-4-Nitroquinoline 1-Oxide; Brn 0199266 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5ClN2O3 |
| Molecular Weight | 224.60 |
| CAS Registry Number | 3741-12-6 |
| SMILES | C1=CC2=C(C=C1Cl)C(=CC=[N+]2[O-])[N+]([O-])=O |
| InChI | 1S/C9H5ClN2O3/c10-6-1-2-8-7(5-6)9(12(14)15)3-4-11(8)13/h1-5H |
| InChIKey | WJRQJTJYCZGDBW-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.401°C at 760 mmHg (Cal.) |
| Flash point | 207.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-4-Nitro-1-Oxidoquinolin-1-Ium |