|
CAS#: 37433-35-5 Product: 2-Methyl-2-Propenoic acid polymer with ethene and 2-methylpropyl2-propenoate No suppilers available for the product. |
| Name | 2-Methyl-2-Propenoic acid polymer with ethene and 2-methylpropyl2-propenoate |
|---|---|
| Synonyms | Ethylene; 4-Methyl-2-Methylene-Pentanoic Acid; 2-Methylprop-2-Enoic Acid; Ethylene; 4-Methyl-2-Methylenepentanoic Acid; 2-Methylprop-2-Enoic Acid |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 |
| CAS Registry Number | 37433-35-5 |
| SMILES | C(C(C(=O)O)=C)C(C)C.CC(C(=O)O)=C.C=C |
| InChI | 1S/C7H12O2.C4H6O2.C2H4/c1-5(2)4-6(3)7(8)9;1-3(2)4(5)6;1-2/h5H,3-4H2,1-2H3,(H,8,9);1H2,2H3,(H,5,6);1-2H2 |
| InChIKey | CSKSMTASUDRSJD-UHFFFAOYSA-N |
| Boiling point | 213.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 120.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propenoic acid polymer with ethene and 2-methylpropyl2-propenoate |