|
CAS#: 3757-76-4 Product: Sodium 2,4-Dichlorophenolate No suppilers available for the product. |
| Name | Sodium 2,4-Dichlorophenolate |
|---|---|
| Synonyms | Phenol, 2,4-Dichloro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl2NaO |
| Molecular Weight | 184.98 |
| CAS Registry Number | 3757-76-4 |
| EINECS | 223-163-1 |
| SMILES | C1=C(C(=CC(=C1)Cl)Cl)[O-].[Na+] |
| InChI | 1S/C6H4Cl2O.Na/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H;/q;+1/p-1 |
| InChIKey | BYOIUZNBVLCMNV-UHFFFAOYSA-M |
| Boiling point | 210°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,4-Dichlorophenolate |