|
CAS#: 376-22-7 Product: 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Octadecafluoronon-1-Ene No suppilers available for the product. |
| Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Octadecafluoronon-1-Ene |
|---|---|
| Synonyms | Perfluoronon-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.07 |
| CAS Registry Number | 376-22-7 |
| EINECS | 206-807-6 |
| SMILES | C(=C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F)(F)F |
| InChI | 1S/C9F18/c10-1(2(11)12)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)27 |
| InChIKey | UAFOIVDGAVVKTE-UHFFFAOYSA-N |
| Density | 1.675g/cm3 (Cal.) |
|---|---|
| Boiling point | 131.9°C at 760 mmHg (Cal.) |
| Flash point | 42.48°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Octadecafluoronon-1-Ene |