|
CAS#: 376-34-1 Product: Azanium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate No suppilers available for the product. |
| Name | Azanium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate |
|---|---|
| Synonyms | Ammonium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate; Ammonium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroenanthate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5F12NO2 |
| Molecular Weight | 363.10 |
| CAS Registry Number | 376-34-1 |
| EINECS | 206-809-7 |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[NH4+] |
| InChI | 1S/C7H2F12O2.H3N/c8-1(9)3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(20)21;/h1H,(H,20,21);1H3 |
| InChIKey | XLOKWMRUDKMDSC-UHFFFAOYSA-N |
| Boiling point | 188.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 67.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azanium 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoate |