|
CAS#: 37652-60-1 Product: 1-(1-Methylethyl)-4-((2-(phenylmethyl)phenyl)methyl)piperazine maleate No suppilers available for the product. |
| Name | 1-(1-Methylethyl)-4-((2-(phenylmethyl)phenyl)methyl)piperazine maleate |
|---|---|
| Synonyms | 1-[(2-Benzylphenyl)Methyl]-4-Isopropyl-Piperazine; But-2-Enedioic Acid; 1-[(2-Benzylphenyl)Methyl]-4-Isopropylpiperazine; But-2-Enedioic Acid; 1-(2-Benzylbenzyl)-4-Isopropyl-Piperazine; But-2-Enedioic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 |
| CAS Registry Number | 37652-60-1 |
| SMILES | O=C(O)\C=C\C(=O)O.C1=C(C(=CC=C1)CC2=CC=CC=C2)CN3CCN(CC3)C(C)C |
| InChI | 1S/C21H28N2.C4H4O4/c1-18(2)23-14-12-22(13-15-23)17-21-11-7-6-10-20(21)16-19-8-4-3-5-9-19;5-3(6)1-2-4(7)8/h3-11,18H,12-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HSJRDQICAHGPFF-WLHGVMLRSA-N |
| Boiling point | 414.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Methylethyl)-4-((2-(phenylmethyl)phenyl)methyl)piperazine maleate |