|
CAS#: 3761-15-7 Product: 1-(2,4-Dinitrophenoxy)Naphthalene No suppilers available for the product. |
| Name | 1-(2,4-Dinitrophenoxy)Naphthalene |
|---|---|
| Synonyms | Nsc404161; Naphthalene, 1-(2,4-Dinitrophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10N2O5 |
| Molecular Weight | 310.27 |
| CAS Registry Number | 3761-15-7 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)OC3=C(C=C(C=C3)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C16H10N2O5/c19-17(20)12-8-9-16(14(10-12)18(21)22)23-15-7-3-5-11-4-1-2-6-13(11)15/h1-10H |
| InChIKey | BCGKQGJTZQCWJZ-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.091°C at 760 mmHg (Cal.) |
| Flash point | 196.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dinitrophenoxy)Naphthalene |