|
CAS#: 3766-27-6 Product: Lithium 2-(2,4-Dichlorophenoxy)Acetate No suppilers available for the product. |
| Name | Lithium 2-(2,4-Dichlorophenoxy)Acetate |
|---|---|
| Synonyms | Lithium 2-(2,4-Dichlorophenoxy)Ethanoate; Lithium 2,4-D; Lithium 2,4-Dichlorophenoxyacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2LiO3 |
| Molecular Weight | 226.97 |
| CAS Registry Number | 3766-27-6 |
| SMILES | C1=C(C(=CC(=C1)Cl)Cl)OCC(=O)[O-].[Li+] |
| InChI | 1S/C8H6Cl2O3.Li/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
| InChIKey | WBGFKUKWGNKHTN-UHFFFAOYSA-M |
| Boiling point | 345.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 162.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Lithium 2-(2,4-Dichlorophenoxy)Acetate |