|
CAS#: 37722-77-3 Product: Ethyl 2-(3,3-Dimethylcyclohexylidene)Acetate No suppilers available for the product. |
| Name | Ethyl 2-(3,3-Dimethylcyclohexylidene)Acetate |
|---|---|
| Synonyms | Ethyl (2E)-2-(3,3-Dimethylcyclohexylidene)Acetate; 2-(3,3-Dimethylcyclohexylidene)Acetic Acid Ethyl Ester; (2E)-2-(3,3-Dimethylcyclohexylidene)Acetic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 37722-77-3 |
| SMILES | C(OC(/C=C1/CC(CCC1)(C)C)=O)C |
| InChI | 1S/C12H20O2/c1-4-14-11(13)8-10-6-5-7-12(2,3)9-10/h8H,4-7,9H2,1-3H3/b10-8+ |
| InChIKey | BKHNGPZOPOPDCJ-CSKARUKUSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.348°C at 760 mmHg (Cal.) |
| Flash point | 111.688°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(3,3-Dimethylcyclohexylidene)Acetate |