|
CAS#: 37764-61-7 Product: N-(3,4-Dichlorophenyl)-3-Hydroxy-2-Methylpentanamide No suppilers available for the product. |
| Name | N-(3,4-Dichlorophenyl)-3-Hydroxy-2-Methylpentanamide |
|---|---|
| Synonyms | N-(3,4-Dichlorophenyl)-3-hydroxy-2-methylpentanamide; N-(3,4-Dichlorophenyl)-3-hydroxy-2-methylpentanamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 |
| CAS Registry Number | 37764-61-7 |
| SMILES | Clc1ccc(NC(=O)C(C)C(O)CC)cc1Cl |
| InChI | 1S/C12H15Cl2NO2/c1-3-11(16)7(2)12(17)15-8-4-5-9(13)10(14)6-8/h4-7,11,16H,3H2,1-2H3,(H,15,17) |
| InChIKey | FGAQZCYRMUCCIF-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.212°C at 760 mmHg (Cal.) |
| Flash point | 224.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,4-Dichlorophenyl)-3-Hydroxy-2-Methylpentanamide |