|
CAS#: 38032-13-2 Product: Phenyl(4-Nitrophenyl) Ketone Oxime No suppilers available for the product. |
| Name | Phenyl(4-Nitrophenyl) Ketone Oxime |
|---|---|
| Synonyms | (4-Nitrophenyl)-Phenyl-Methanone Oxime; (4-Nitrophenyl)-Phenylmethanone Oxime; (Nz)-N-[(4-Nitrophenyl)-Phenyl-Methylidene]Hydroxylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 38032-13-2 |
| SMILES | C2=C(\C(=N/O)C1=CC=CC=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C13H10N2O3/c16-14-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)15(17)18/h1-9,16H/b14-13- |
| InChIKey | LNOLJFCCYQZFBQ-YPKPFQOOSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.023°C at 760 mmHg (Cal.) |
| Flash point | 208.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(4-Nitrophenyl) Ketone Oxime |