|
CAS#: 3813-93-2 Product: 2-(4-Hydroxyphenyl)-4(1H)-Quinolinone No suppilers available for the product. |
| Name | 2-(4-Hydroxyphenyl)-4(1H)-Quinolinone |
|---|---|
| Synonyms | 2-(4-Hydroxy-phenyl)-1H-quinolin-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25 |
| CAS Registry Number | 3813-93-2 |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(N2)C3=CC=C(C=C3)O |
| InChI | 1S/C15H11NO2/c17-11-7-5-10(6-8-11)14-9-15(18)12-3-1-2-4-13(12)16-14/h1-9,17H,(H,16,18) |
| InChIKey | NFHVMJUQDROCSJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 222.3±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Hydroxyphenyl)-4(1H)-Quinolinone |