Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (1204) 527-700 | |||
|
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 4-[(2-Aminoacetyl)Amino]Benzoate |
|---|---|
| Synonyms | 4-[(2-Amino-1-Oxoethyl)Amino]Benzoic Acid Ethyl Ester; 4-(Glycylamino)Benzoic Acid Ethyl Ester; Ethyl 4-(2-Aminoethanoylamino)Benzoate |
| Molecular Structure | ![CAS#: 38219-44-2, Ethyl 4-[(2-Aminoacetyl)Amino]Benzoate](/moreStructures/38219-44-2.gif) |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 38219-44-2 |
| SMILES | C1=C(C(OCC)=O)C=CC(=C1)NC(=O)CN |
| InChI | 1S/C11H14N2O3/c1-2-16-11(15)8-3-5-9(6-4-8)13-10(14)7-12/h3-6H,2,7,12H2,1H3,(H,13,14) |
| InChIKey | GUXAWDGROAAJBL-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.255°C at 760 mmHg (Cal.) |
| Flash point | 213.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-[(2-Aminoacetyl)Amino]Benzoate |