|
CAS#: 38261-24-4 Product: N-(Diaminomethylideneamino)Pyridine-3-Carboxamide sulfate No suppilers available for the product. |
| Name | N-(Diaminomethylideneamino)Pyridine-3-Carboxamide sulfate |
|---|---|
| Synonyms | N-Guanidinopyridine-3-Carboxamide; Sulfuric Acid; N-Guanidino-3-Pyridinecarboxamide; Sulfuric Acid; N-Guanidinonicotinamide; Sulfuric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N10O6S |
| Molecular Weight | 456.44 |
| CAS Registry Number | 38261-24-4 |
| SMILES | O=[S](O)(O)=O.C1=CC=NC=C1C(=O)NN=C(N)N.C2=CC=NC=C2C(=O)NN=C(N)N |
| InChI | 1S/2C7H9N5O.H2O4S/c2*8-7(9)12-11-6(13)5-2-1-3-10-4-5;1-5(2,3)4/h2*1-4H,(H,11,13)(H4,8,9,12);(H2,1,2,3,4) |
| InChIKey | ZPQICFOXBGTGCI-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for N-(Diaminomethylideneamino)Pyridine-3-Carboxamide sulfate |