|
CAS#: 38284-11-6 Product: 1,3,3-Trimethyl-7-Oxabicyclo[4.1.0]Heptane-2,5-Dione No suppilers available for the product. |
| Name | 1,3,3-Trimethyl-7-Oxabicyclo[4.1.0]Heptane-2,5-Dione |
|---|---|
| Synonyms | 2,3-Epoxy-2,6,6-trimethyl-1,4-cyclohexanedione; 3,5,5-Trimethyl-2,3-epoxycyclohexane-1,4-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 |
| CAS Registry Number | 38284-11-6 |
| SMILES | O=C1CC(C(=O)C2(OC12)C)(C)C |
| InChI | 1S/C9H12O3/c1-8(2)4-5(10)6-9(3,12-6)7(8)11/h6H,4H2,1-3H3 |
| InChIKey | VOFRQXZPJRQJIW-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.546°C at 760 mmHg (Cal.) |
| Flash point | 114.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethyl-7-Oxabicyclo[4.1.0]Heptane-2,5-Dione |